C34H40N2O4 — CID 144562832
5-[4-[3-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)phenyl]-3,5-dimethylphenoxy]-2,2-dimethylpentanenitrile;ethyl formate (PubChem CID 144562832) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is 5-[4-[3-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)phenyl]-3,5-dimethylphenoxy]-2,2-dimethylpentanenitrile;ethyl formate.
| Compound Name | 5-[4-[3-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)phenyl]-3,5-dimethylphenoxy]-2,2-dimethylpentanenitrile;ethyl formate |
|---|---|
| PubChem CID | 144562832 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 5-[4-[3-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)phenyl]-3,5-dimethylphenoxy]-2,2-dimethylpentanenitrile;ethyl formate |
| SMILES | CCOC=O.Cc1cc(OCCCC(C)(C)C#N)cc(C)c1-c1cccc(COc2cc3c(cn2)C2CC2C3)c1 |
| InChI | InChI=1S/C31H34N2O2.C3H6O2/c1-20-11-26(34-10-6-9-31(3,4)19-32)12-21(2)30(20)23-8-5-7-22(13-23)18-35-29-16-25-14-24-15-27(24)28(25)17-33-29;1-2-5-3-4/h5,7-8,11-13,16-17,24,27H,6,9-10,14-15,18H2,1-4H3;3H,2H2,1H3 |
| InChIKey | JNEKNNGGTNFVKY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|