C33H42O2 — CID 144566051
(2Z,3Z)-3-[2-[[3-[4-(4,4-dimethylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]prop-2-enylidene]-2-ethylidenebicyclo[3.1.0]hexane (PubChem CID 144566051) has the molecular formula C33H42O2 and a molecular weight of 470.70 g/mol. Its IUPAC name is (2Z,3Z)-3-[2-[[3-[4-(4,4-dimethylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]prop-2-enylidene]-2-ethylidenebicyclo[3.1.0]hexane.
| Compound Name | (2Z,3Z)-3-[2-[[3-[4-(4,4-dimethylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]prop-2-enylidene]-2-ethylidenebicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 144566051 |
| Molecular Formula | C33H42O2 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (2Z,3Z)-3-[2-[[3-[4-(4,4-dimethylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]prop-2-enylidene]-2-ethylidenebicyclo[3.1.0]hexane |
| SMILES | C=C(/C=C1/CC2CC2/C1=C/C)OCc1cccc(-c2c(C)cc(OCCCC(C)(C)C)cc2C)c1 |
| InChI | InChI=1S/C33H42O2/c1-8-30-27(19-28-20-31(28)30)17-24(4)35-21-25-11-9-12-26(18-25)32-22(2)15-29(16-23(32)3)34-14-10-13-33(5,6)7/h8-9,11-12,15-18,28,31H,4,10,13-14,19-21H2,1-3,5-7H3/b27-17-,30-8+ |
| InChIKey | RZQGLNMLQPYIRW-FOORWVPGSA-N |
| XLogP | 9.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|