C27H27NO4S — CID 123451038
5-[4-[[3-[4-(3-hydroxypropoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1,2-thiazol-3-one (PubChem CID 123451038) has the molecular formula C27H27NO4S and a molecular weight of 461.58 g/mol. Its IUPAC name is 5-[4-[[3-[4-(3-hydroxypropoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1,2-thiazol-3-one.
| Compound Name | 5-[4-[[3-[4-(3-hydroxypropoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 123451038 |
| Molecular Formula | C27H27NO4S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 5-[4-[[3-[4-(3-hydroxypropoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1,2-thiazol-3-one |
| SMILES | Cc1cc(OCCCO)cc(C)c1-c1cccc(COc2ccc(-c3cc(=O)[nH]s3)cc2)c1 |
| InChI | InChI=1S/C27H27NO4S/c1-18-13-24(31-12-4-11-29)14-19(2)27(18)22-6-3-5-20(15-22)17-32-23-9-7-21(8-10-23)25-16-26(30)28-33-25/h3,5-10,13-16,29H,4,11-12,17H2,1-2H3,(H,28,30) |
| InChIKey | LTUSSKJJZQNYQY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|