C28H31NO3S — CID 140674519
5-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-2,3-dihydro-1,2-thiazole (PubChem CID 140674519) has the molecular formula C28H31NO3S and a molecular weight of 461.63 g/mol. Its IUPAC name is 5-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-2,3-dihydro-1,2-thiazole.
| Compound Name | 5-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-2,3-dihydro-1,2-thiazole |
|---|---|
| PubChem CID | 140674519 |
| Molecular Formula | C28H31NO3S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 5-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-2,3-dihydro-1,2-thiazole |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(COc3ccc(C4=CCNS4)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C28H31NO3S/c1-4-30-14-15-31-26-16-20(2)28(21(3)17-26)24-7-5-6-22(18-24)19-32-25-10-8-23(9-11-25)27-12-13-29-33-27/h5-12,16-18,29H,4,13-15,19H2,1-3H3 |
| InChIKey | DMJOKXHEKHQRCW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|