C21H29NO4S — CID 118398659
N-[3-[4-[3-(ethoxymethyl)phenyl]-3,5-dimethylphenoxy]propyl]methanesulfonamide (PubChem CID 118398659) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is N-[3-[4-[3-(ethoxymethyl)phenyl]-3,5-dimethylphenoxy]propyl]methanesulfonamide.
| Compound Name | N-[3-[4-[3-(ethoxymethyl)phenyl]-3,5-dimethylphenoxy]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 118398659 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[3-[4-[3-(ethoxymethyl)phenyl]-3,5-dimethylphenoxy]propyl]methanesulfonamide |
| SMILES | CCOCc1cccc(-c2c(C)cc(OCCCNS(C)(=O)=O)cc2C)c1 |
| InChI | InChI=1S/C21H29NO4S/c1-5-25-15-18-8-6-9-19(14-18)21-16(2)12-20(13-17(21)3)26-11-7-10-22-27(4,23)24/h6,8-9,12-14,22H,5,7,10-11,15H2,1-4H3 |
| InChIKey | POLBXZAJCFESQH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|