C31H36O5S — CID 129156077
3-[(1S)-5-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-1-yl]prop-1-en-2-ol (PubChem CID 129156077) has the molecular formula C31H36O5S and a molecular weight of 520.69 g/mol. Its IUPAC name is 3-[(1S)-5-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-1-yl]prop-1-en-2-ol.
| Compound Name | 3-[(1S)-5-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-1-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 129156077 |
| Molecular Formula | C31H36O5S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 3-[(1S)-5-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-1-yl]prop-1-en-2-ol |
| SMILES | C=C(O)C[C@@H]1CCc2cc(OCc3cccc(-c4c(C)cc(OCCCS(C)(=O)=O)cc4C)c3)ccc21 |
| InChI | InChI=1S/C31H36O5S/c1-21-15-29(35-13-6-14-37(4,33)34)16-22(2)31(21)27-8-5-7-24(18-27)20-36-28-11-12-30-25(17-23(3)32)9-10-26(30)19-28/h5,7-8,11-12,15-16,18-19,25,32H,3,6,9-10,13-14,17,20H2,1-2,4H3/t25-/m0/s1 |
| InChIKey | FQSKCKAYSDPMSL-VWLOTQADSA-N |
| XLogP | 6.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|