C28H30N2O7S2 — CID 151834663
5-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]-1,1-dioxo-4H-1,2,6-thiadiazin-3-one (PubChem CID 151834663) has the molecular formula C28H30N2O7S2 and a molecular weight of 570.69 g/mol. Its IUPAC name is 5-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]-1,1-dioxo-4H-1,2,6-thiadiazin-3-one.
| Compound Name | 5-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]-1,1-dioxo-4H-1,2,6-thiadiazin-3-one |
|---|---|
| PubChem CID | 151834663 |
| Molecular Formula | C28H30N2O7S2 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 5-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]-1,1-dioxo-4H-1,2,6-thiadiazin-3-one |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1cccc(COc2ccc(C3=NS(=O)(=O)NC(=O)C3)cc2)c1 |
| InChI | InChI=1S/C28H30N2O7S2/c1-19-14-25(36-12-5-13-38(3,32)33)15-20(2)28(19)23-7-4-6-21(16-23)18-37-24-10-8-22(9-11-24)26-17-27(31)30-39(34,35)29-26/h4,6-11,14-16H,5,12-13,17-18H2,1-3H3,(H,30,31) |
| InChIKey | SFJZZDSXUPMZHE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|