C27H27FO5S — CID 141318546
6-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-5-fluoro-1-benzofuran (PubChem CID 141318546) has the molecular formula C27H27FO5S and a molecular weight of 482.57 g/mol. Its IUPAC name is 6-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-5-fluoro-1-benzofuran.
| Compound Name | 6-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-5-fluoro-1-benzofuran |
|---|---|
| PubChem CID | 141318546 |
| Molecular Formula | C27H27FO5S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 6-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]-5-fluoro-1-benzofuran |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1cccc(COc2cc3occc3cc2F)c1 |
| InChI | InChI=1S/C27H27FO5S/c1-18-12-23(31-9-5-11-34(3,29)30)13-19(2)27(18)22-7-4-6-20(14-22)17-33-26-16-25-21(8-10-32-25)15-24(26)28/h4,6-8,10,12-16H,5,9,11,17H2,1-3H3 |
| InChIKey | AYKFOZRJJLCEIX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|