C30H35F2NO4 — CID 23157621
ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoate (PubChem CID 23157621) has the molecular formula C30H35F2NO4 and a molecular weight of 511.61 g/mol. Its IUPAC name is ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoate.
| Compound Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 23157621 |
| Molecular Formula | C30H35F2NO4 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]phenyl]-2,2-difluoropropanoate |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(CNc3ccc(CC(F)(F)C(=O)OCC)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C30H35F2NO4/c1-5-35-14-15-37-27-16-21(3)28(22(4)17-27)25-9-7-8-24(18-25)20-33-26-12-10-23(11-13-26)19-30(31,32)29(34)36-6-2/h7-13,16-18,33H,5-6,14-15,19-20H2,1-4H3 |
| InChIKey | PLUCQRDNPPPDJS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|