C31H35FN2O4 — CID 12002200
3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid (PubChem CID 12002200) has the molecular formula C31H35FN2O4 and a molecular weight of 518.63 g/mol. Its IUPAC name is 3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 12002200 |
| Molecular Formula | C31H35FN2O4 |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoic acid |
| SMILES | Cc1cc(OCCCN2CCCC2=O)cc(C)c1-c1cccc(CNc2ccc(CCC(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C31H35FN2O4/c1-21-16-27(38-15-5-14-34-13-4-8-29(34)35)17-22(2)31(21)25-7-3-6-23(18-25)20-33-26-11-9-24(28(32)19-26)10-12-30(36)37/h3,6-7,9,11,16-19,33H,4-5,8,10,12-15,20H2,1-2H3,(H,36,37) |
| InChIKey | KINNMYMEYKIXDQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|