C37H39FN2O6S — CID 87548793
benzenesulfonyl 3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoate (PubChem CID 87548793) has the molecular formula C37H39FN2O6S and a molecular weight of 658.79 g/mol. Its IUPAC name is benzenesulfonyl 3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoate.
| Compound Name | benzenesulfonyl 3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 87548793 |
| Molecular Formula | C37H39FN2O6S |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | benzenesulfonyl 3-[4-[[3-[2,6-dimethyl-4-[3-(2-oxopyrrolidin-1-yl)propoxy]phenyl]phenyl]methylamino]-2-fluorophenyl]propanoate |
| SMILES | Cc1cc(OCCCN2CCCC2=O)cc(C)c1-c1cccc(CNc2ccc(CCC(=O)OS(=O)(=O)c3ccccc3)c(F)c2)c1 |
| InChI | InChI=1S/C37H39FN2O6S/c1-26-21-32(45-20-8-19-40-18-7-13-35(40)41)22-27(2)37(26)30-10-6-9-28(23-30)25-39-31-16-14-29(34(38)24-31)15-17-36(42)46-47(43,44)33-11-4-3-5-12-33/h3-6,9-12,14,16,21-24,39H,7-8,13,15,17-20,25H2,1-2H3 |
| InChIKey | LLBVCKWBZJWQOC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|