C32H40FNO4 — CID 23157425
ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate (PubChem CID 23157425) has the molecular formula C32H40FNO4 and a molecular weight of 521.67 g/mol. Its IUPAC name is ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate.
| Compound Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 23157425 |
| Molecular Formula | C32H40FNO4 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,5,6-tetramethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate |
| SMILES | CCOCCOc1c(C)c(C)c(-c2cccc(CNc3ccc(CCC(=O)OCC)c(F)c3)c2)c(C)c1C |
| InChI | InChI=1S/C32H40FNO4/c1-7-36-16-17-38-32-23(5)21(3)31(22(4)24(32)6)27-11-9-10-25(18-27)20-34-28-14-12-26(29(33)19-28)13-15-30(35)37-8-2/h9-12,14,18-19,34H,7-8,13,15-17,20H2,1-6H3 |
| InChIKey | FEPJSPNQYDEOHE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|