C18H20F2N2O2 — CID 171240145
ethyl (3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropanoate (PubChem CID 171240145) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropanoate.
| Compound Name | ethyl (3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 171240145 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | ethyl (3R)-3-amino-3-[4-(benzylamino)phenyl]-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20F2N2O2/c1-2-24-17(23)18(19,20)16(21)14-8-10-15(11-9-14)22-12-13-6-4-3-5-7-13/h3-11,16,22H,2,12,21H2,1H3/t16-/m1/s1 |
| InChIKey | PJXSGVLKUBGFER-MRXNPFEDSA-N |
| XLogP | 3.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |