C29H33NO4 — CID 143103938
2-[6-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde (PubChem CID 143103938) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[6-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde.
| Compound Name | 2-[6-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 143103938 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-[6-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methylamino]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(CNc3ccc4c(c3)OCC4CC=O)c2)c(C)c1 |
| InChI | InChI=1S/C29H33NO4/c1-4-32-12-13-33-26-14-20(2)29(21(3)15-26)23-7-5-6-22(16-23)18-30-25-8-9-27-24(10-11-31)19-34-28(27)17-25/h5-9,11,14-17,24,30H,4,10,12-13,18-19H2,1-3H3 |
| InChIKey | TYRGMNNYZDKARN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|