C29H32O5S — CID 167220612
2-[6-[[3-[2,6-dimethyl-4-(3-methylsulfinylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde (PubChem CID 167220612) has the molecular formula C29H32O5S and a molecular weight of 492.64 g/mol. Its IUPAC name is 2-[6-[[3-[2,6-dimethyl-4-(3-methylsulfinylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde.
| Compound Name | 2-[6-[[3-[2,6-dimethyl-4-(3-methylsulfinylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 167220612 |
| Molecular Formula | C29H32O5S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-[6-[[3-[2,6-dimethyl-4-(3-methylsulfinylpropoxy)phenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetaldehyde |
| SMILES | Cc1cc(OCCCS(C)=O)cc(C)c1-c1cccc(COc2ccc3c(c2)OCC3CC=O)c1 |
| InChI | InChI=1S/C29H32O5S/c1-20-14-26(32-12-5-13-35(3)31)15-21(2)29(20)23-7-4-6-22(16-23)18-33-25-8-9-27-24(10-11-30)19-34-28(27)17-25/h4,6-9,11,14-17,24H,5,10,12-13,18-19H2,1-3H3 |
| InChIKey | WZGIMYSSBPOUOB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|