C31H36ClNO7S — CID 141472801
methyl 2-[(3S)-6-[[3-[4-[2-(3-chloropropylsulfonylamino)ethoxy]-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetate (PubChem CID 141472801) has the molecular formula C31H36ClNO7S and a molecular weight of 602.15 g/mol. Its IUPAC name is methyl 2-[(3S)-6-[[3-[4-[2-(3-chloropropylsulfonylamino)ethoxy]-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-6-[[3-[4-[2-(3-chloropropylsulfonylamino)ethoxy]-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 141472801 |
| Molecular Formula | C31H36ClNO7S |
| Molecular Weight | 602.15 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | methyl 2-[(3S)-6-[[3-[4-[2-(3-chloropropylsulfonylamino)ethoxy]-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1-benzofuran-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1COc2cc(OCc3cccc(-c4c(C)cc(OCCNS(=O)(=O)CCCCl)cc4C)c3)ccc21 |
| InChI | InChI=1S/C31H36ClNO7S/c1-21-14-27(38-12-11-33-41(35,36)13-5-10-32)15-22(2)31(21)24-7-4-6-23(16-24)19-39-26-8-9-28-25(17-30(34)37-3)20-40-29(28)18-26/h4,6-9,14-16,18,25,33H,5,10-13,17,19-20H2,1-3H3/t25-/m1/s1 |
| InChIKey | GKNYPIGQJRJNIG-RUZDIDTESA-N |
| XLogP | 5.52 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.15 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|