C28H30FNO5S — CID 56960398
5-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1-oxo-1,2-thiazolidin-3-one (PubChem CID 56960398) has the molecular formula C28H30FNO5S and a molecular weight of 511.62 g/mol. Its IUPAC name is 5-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1-oxo-1,2-thiazolidin-3-one.
| Compound Name | 5-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1-oxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 56960398 |
| Molecular Formula | C28H30FNO5S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 5-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-1-oxo-1,2-thiazolidin-3-one |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(COc3ccc(C4CC(=O)NS4=O)cc3)c2)c(C)c1F |
| InChI | InChI=1S/C28H30FNO5S/c1-4-33-12-13-34-24-14-18(2)27(19(3)28(24)29)22-7-5-6-20(15-22)17-35-23-10-8-21(9-11-23)25-16-26(31)30-36(25)32/h5-11,14-15,25H,4,12-13,16-17H2,1-3H3,(H,30,31) |
| InChIKey | WBXBACNXYJFXTJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|