C29H33NO6S — CID 71815086
5-[4-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]-2-methoxyphenyl]-1,1-dioxothiazinan-3-one (PubChem CID 71815086) has the molecular formula C29H33NO6S and a molecular weight of 523.65 g/mol. Its IUPAC name is 5-[4-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]-2-methoxyphenyl]-1,1-dioxothiazinan-3-one.
| Compound Name | 5-[4-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]-2-methoxyphenyl]-1,1-dioxothiazinan-3-one |
|---|---|
| PubChem CID | 71815086 |
| Molecular Formula | C29H33NO6S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 5-[4-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]-2-methoxyphenyl]-1,1-dioxothiazinan-3-one |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(-c3ccc(C4CC(=O)NS(=O)(=O)C4)c(OC)c3)c2)c(C)c1 |
| InChI | InChI=1S/C29H33NO6S/c1-5-35-11-12-36-25-13-19(2)29(20(3)14-25)23-8-6-7-21(15-23)22-9-10-26(27(16-22)34-4)24-17-28(31)30-37(32,33)18-24/h6-10,13-16,24H,5,11-12,17-18H2,1-4H3,(H,30,31) |
| InChIKey | QSPOYVAXHCHCRN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|