C31H35NO3 — CID 144792040
4-[2-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]quinolin-6-yl]butan-2-ol (PubChem CID 144792040) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is 4-[2-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]quinolin-6-yl]butan-2-ol.
| Compound Name | 4-[2-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]quinolin-6-yl]butan-2-ol |
|---|---|
| PubChem CID | 144792040 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 4-[2-[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]quinolin-6-yl]butan-2-ol |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(-c3ccc4cc(CCC(C)O)ccc4n3)c2)c(C)c1 |
| InChI | InChI=1S/C31H35NO3/c1-5-34-15-16-35-28-17-21(2)31(22(3)18-28)27-8-6-7-25(20-27)30-14-12-26-19-24(10-9-23(4)33)11-13-29(26)32-30/h6-8,11-14,17-20,23,33H,5,9-10,15-16H2,1-4H3 |
| InChIKey | DGWPYBLCRFEKEX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|