C27H40O7 — CID 23147308
4-[3-[3-ethyl-2-[2-(2-methoxyethoxy)ethyl]-4,6-bis(methoxymethoxy)phenyl]phenyl]butan-2-ol (PubChem CID 23147308) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is 4-[3-[3-ethyl-2-[2-(2-methoxyethoxy)ethyl]-4,6-bis(methoxymethoxy)phenyl]phenyl]butan-2-ol.
| Compound Name | 4-[3-[3-ethyl-2-[2-(2-methoxyethoxy)ethyl]-4,6-bis(methoxymethoxy)phenyl]phenyl]butan-2-ol |
|---|---|
| PubChem CID | 23147308 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 4-[3-[3-ethyl-2-[2-(2-methoxyethoxy)ethyl]-4,6-bis(methoxymethoxy)phenyl]phenyl]butan-2-ol |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2cccc(CCC(C)O)c2)c1CCOCCOC |
| InChI | InChI=1S/C27H40O7/c1-6-23-24(12-13-32-15-14-29-3)27(22-9-7-8-21(16-22)11-10-20(2)28)26(34-19-31-5)17-25(23)33-18-30-4/h7-9,16-17,20,28H,6,10-15,18-19H2,1-5H3 |
| InChIKey | ZAJSYJFNMYPXRT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|