C24H33NO6 — CID 23147428
2-[3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propoxy]-N-methylacetamide (PubChem CID 23147428) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propoxy]-N-methylacetamide.
| Compound Name | 2-[3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 23147428 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 2-[3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propoxy]-N-methylacetamide |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCCOCC(=O)NC |
| InChI | InChI=1S/C24H33NO6/c1-5-19-20(12-9-13-29-15-23(26)25-2)24(18-10-7-6-8-11-18)22(31-17-28-4)14-21(19)30-16-27-3/h6-8,10-11,14H,5,9,12-13,15-17H2,1-4H3,(H,25,26) |
| InChIKey | HOBITDUBNLCUDJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|