C21H26BrNO6 — CID 23147478
2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-(2-methoxyethyl)acetamide (PubChem CID 23147478) has the molecular formula C21H26BrNO6 and a molecular weight of 468.34 g/mol. Its IUPAC name is 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 23147478 |
| Molecular Formula | C21H26BrNO6 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1c(Br)c(OCOC)cc(OCOC)c1-c1ccccc1 |
| InChI | InChI=1S/C21H26BrNO6/c1-25-10-9-23-19(24)11-16-20(15-7-5-4-6-8-15)17(28-13-26-2)12-18(21(16)22)29-14-27-3/h4-8,12H,9-11,13-14H2,1-3H3,(H,23,24) |
| InChIKey | RNJQRHJAWYJJQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|