C21H28O5 — CID 23147311
3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propan-1-ol (PubChem CID 23147311) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propan-1-ol.
| Compound Name | 3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propan-1-ol |
|---|---|
| PubChem CID | 23147311 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 3-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]propan-1-ol |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCCO |
| InChI | InChI=1S/C21H28O5/c1-4-17-18(11-8-12-22)21(16-9-6-5-7-10-16)20(26-15-24-3)13-19(17)25-14-23-2/h5-7,9-10,13,22H,4,8,11-12,14-15H2,1-3H3 |
| InChIKey | KSWOMZBYLLJSQB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|