C23H32O4 — CID 130301437
3-[3-(3-hydroxypropoxy)-2-pentyl-5-phenylphenoxy]propan-1-ol (PubChem CID 130301437) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-[3-(3-hydroxypropoxy)-2-pentyl-5-phenylphenoxy]propan-1-ol.
| Compound Name | 3-[3-(3-hydroxypropoxy)-2-pentyl-5-phenylphenoxy]propan-1-ol |
|---|---|
| PubChem CID | 130301437 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3-[3-(3-hydroxypropoxy)-2-pentyl-5-phenylphenoxy]propan-1-ol |
| SMILES | CCCCCc1c(OCCCO)cc(-c2ccccc2)cc1OCCCO |
| InChI | InChI=1S/C23H32O4/c1-2-3-5-12-21-22(26-15-8-13-24)17-20(19-10-6-4-7-11-19)18-23(21)27-16-9-14-25/h4,6-7,10-11,17-18,24-25H,2-3,5,8-9,12-16H2,1H3 |
| InChIKey | TUGDGFDRFZPKPU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|