C17H20S — CID 174451877
pentane-1-thiol;3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 174451877) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is pentane-1-thiol;3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | pentane-1-thiol;3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 174451877 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | pentane-1-thiol;3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | CCCCCS.c1ccc(-c2cc3cc-3c2)cc1 |
| InChI | InChI=1S/C12H8.C5H12S/c1-2-4-9(5-3-1)10-6-11-8-12(11)7-10;1-2-3-4-5-6/h1-8H;6H,2-5H2,1H3 |
| InChIKey | ANLPEFFJCQMQCB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|