C21H22N+ — CID 71382796
1-butyl-3,5-diphenylpyridin-1-ium (PubChem CID 71382796) has the molecular formula C21H22N+ and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-butyl-3,5-diphenylpyridin-1-ium.
| Compound Name | 1-butyl-3,5-diphenylpyridin-1-ium |
|---|---|
| PubChem CID | 71382796 |
| Molecular Formula | C21H22N+ |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-butyl-3,5-diphenylpyridin-1-ium |
| SMILES | CCCC[n+]1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H22N/c1-2-3-14-22-16-20(18-10-6-4-7-11-18)15-21(17-22)19-12-8-5-9-13-19/h4-13,15-17H,2-3,14H2,1H3/q+1 |
| InChIKey | DVBRZKNABBZOLK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|