C26H24NO2+ — CID 152900593
5-[3-(3,5-diphenylpyridin-1-ium-1-yl)propyl]benzene-1,3-diol (PubChem CID 152900593) has the molecular formula C26H24NO2+ and a molecular weight of 382.48 g/mol. Its IUPAC name is 5-[3-(3,5-diphenylpyridin-1-ium-1-yl)propyl]benzene-1,3-diol.
| Compound Name | 5-[3-(3,5-diphenylpyridin-1-ium-1-yl)propyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 152900593 |
| Molecular Formula | C26H24NO2+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-[3-(3,5-diphenylpyridin-1-ium-1-yl)propyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(CCC[n+]2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H23NO2/c28-25-14-20(15-26(29)17-25)8-7-13-27-18-23(21-9-3-1-4-10-21)16-24(19-27)22-11-5-2-6-12-22/h1-6,9-12,14-19H,7-8,13H2,(H-,28,29)/p+1 |
| InChIKey | UFGNHZWGMMSKCJ-UHFFFAOYSA-O |
| XLogP | 5.35 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|