C24H28BrN — CID 24781686
3,5-dimethyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide (PubChem CID 24781686) has the molecular formula C24H28BrN and a molecular weight of 410.40 g/mol. Its IUPAC name is 3,5-dimethyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide.
| Compound Name | 3,5-dimethyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide |
|---|---|
| PubChem CID | 24781686 |
| Molecular Formula | C24H28BrN |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3,5-dimethyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide |
| SMILES | Cc1cc(C)c[n+](CCCCCc2ccc(-c3ccccc3)cc2)c1.[Br-] |
| InChI | InChI=1S/C24H28N.BrH/c1-20-17-21(2)19-25(18-20)16-8-4-5-9-22-12-14-24(15-13-22)23-10-6-3-7-11-23;/h3,6-7,10-15,17-19H,4-5,8-9,16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | DKROHSFMDCYJTB-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|