C23H26BrN — CID 24781680
4-methyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide (PubChem CID 24781680) has the molecular formula C23H26BrN and a molecular weight of 396.37 g/mol. Its IUPAC name is 4-methyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide.
| Compound Name | 4-methyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide |
|---|---|
| PubChem CID | 24781680 |
| Molecular Formula | C23H26BrN |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-methyl-1-[5-(4-phenylphenyl)pentyl]pyridin-1-ium bromide |
| SMILES | Cc1cc[n+](CCCCCc2ccc(-c3ccccc3)cc2)cc1.[Br-] |
| InChI | InChI=1S/C23H26N.BrH/c1-20-15-18-24(19-16-20)17-7-3-4-8-21-11-13-23(14-12-21)22-9-5-2-6-10-22;/h2,5-6,9-16,18-19H,3-4,7-8,17H2,1H3;1H/q+1;/p-1 |
| InChIKey | KSDUHRMKYHFGAZ-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|