C14H16BrN — CID 19969323
4-methyl-1-(2-phenylethyl)pyridin-1-ium bromide (PubChem CID 19969323) has the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. Its IUPAC name is 4-methyl-1-(2-phenylethyl)pyridin-1-ium bromide.
| Compound Name | 4-methyl-1-(2-phenylethyl)pyridin-1-ium bromide |
|---|---|
| PubChem CID | 19969323 |
| Molecular Formula | C14H16BrN |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-methyl-1-(2-phenylethyl)pyridin-1-ium bromide |
| SMILES | Cc1cc[n+](CCc2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C14H16N.BrH/c1-13-7-10-15(11-8-13)12-9-14-5-3-2-4-6-14;/h2-8,10-11H,9,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | QSYZTCQOHVGTSX-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|