C28H38N2+2 — CID 24742848
4-methyl-1-[5-[2-[5-(4-methylpyridin-1-ium-1-yl)pentyl]phenyl]pentyl]pyridin-1-ium (PubChem CID 24742848) has the molecular formula C28H38N2+2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 4-methyl-1-[5-[2-[5-(4-methylpyridin-1-ium-1-yl)pentyl]phenyl]pentyl]pyridin-1-ium.
| Compound Name | 4-methyl-1-[5-[2-[5-(4-methylpyridin-1-ium-1-yl)pentyl]phenyl]pentyl]pyridin-1-ium |
|---|---|
| PubChem CID | 24742848 |
| Molecular Formula | C28H38N2+2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 4-methyl-1-[5-[2-[5-(4-methylpyridin-1-ium-1-yl)pentyl]phenyl]pentyl]pyridin-1-ium |
| SMILES | Cc1cc[n+](CCCCCc2ccccc2CCCCC[n+]2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H38N2/c1-25-15-21-29(22-16-25)19-9-3-5-11-27-13-7-8-14-28(27)12-6-4-10-20-30-23-17-26(2)18-24-30/h7-8,13-18,21-24H,3-6,9-12,19-20H2,1-2H3/q+2 |
| InChIKey | LVMMHOZURJGANH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|