C18H26N2+2 — CID 172537315
3,4-dimethyl-1-[5-(4-methylpyridin-1-ium-1-yl)pentyl]pyridin-1-ium (PubChem CID 172537315) has the molecular formula C18H26N2+2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3,4-dimethyl-1-[5-(4-methylpyridin-1-ium-1-yl)pentyl]pyridin-1-ium.
| Compound Name | 3,4-dimethyl-1-[5-(4-methylpyridin-1-ium-1-yl)pentyl]pyridin-1-ium |
|---|---|
| PubChem CID | 172537315 |
| Molecular Formula | C18H26N2+2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 3,4-dimethyl-1-[5-(4-methylpyridin-1-ium-1-yl)pentyl]pyridin-1-ium |
| SMILES | Cc1cc[n+](CCCCC[n+]2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H26N2/c1-16-7-12-19(13-8-16)10-5-4-6-11-20-14-9-17(2)18(3)15-20/h7-9,12-15H,4-6,10-11H2,1-3H3/q+2 |
| InChIKey | ISMGGKWJHKRNRL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|