About 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide
4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide (PubChem CID 174105717) has the molecular formula C22H38Br4N2+2
and a molecular weight of 650.18 g/mol. Its IUPAC name is 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide.
Molecular Properties
| Compound Name | 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide |
| PubChem CID | 174105717 |
| Molecular Formula | C22H38Br4N2+2 |
| Molecular Weight | 650.18 g/mol |
| Exact Mass | 645.98 |
| IUPAC Name | 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide |
| SMILES | Br.Br.Br.Br.Cc1cc[n+](CCCCCCCCCC[n+]2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H34N2.4BrH/c1-21-11-17-23(18-12-21)15-9-7-5-3-4-6-8-10-16-24-19-13-22(2)14-20-24;;;;/h11-14,17-20H,3-10,15-16H2,1-2H3;4*1H/q+2;;;; |
| InChIKey | KEZLFUQBORHVDR-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.18 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide?
The IUPAC name of 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide (CID 174105717) is 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide.
What is the SMILES notation for 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide?
The canonical SMILES for 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide is Br.Br.Br.Br.Cc1cc[n+](CCCCCCCCCC[n+]2ccc(C)cc2)cc1.
What is the InChIKey of 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide?
The InChIKey is KEZLFUQBORHVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N2.4BrH/c1-21-11-17-23(18-12-21)15-9-7-5-3-4-6-8-10-16-24-19-13-22(2)14-20-24;;;;/h11-14,17-20H,3-10,15-16H2,1-2H3;4*1H/q+2;;;;.
What are the key properties of 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide?
4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide has a molecular weight of 650.18 g/mol, XLogP of 7.01, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[10-(4-methylpyridin-1-ium-1-yl)decyl]pyridin-1-ium;tetrahydrobromide is sourced from PubChem (CID 174105717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).