C10H16NO3S+ — CID 13169114
4-(4-methylpyridin-1-ium-1-yl)butane-1-sulfonic acid (PubChem CID 13169114) has the molecular formula C10H16NO3S+ and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-(4-methylpyridin-1-ium-1-yl)butane-1-sulfonic acid.
| Compound Name | 4-(4-methylpyridin-1-ium-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 13169114 |
| Molecular Formula | C10H16NO3S+ |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-(4-methylpyridin-1-ium-1-yl)butane-1-sulfonic acid |
| SMILES | Cc1cc[n+](CCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H15NO3S/c1-10-4-7-11(8-5-10)6-2-3-9-15(12,13)14/h4-5,7-8H,2-3,6,9H2,1H3/p+1 |
| InChIKey | HAHHWLUKPSWAHE-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 58.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|