C10H16NO5S2+ — CID 140687182
4-(4-methylsulfanylperoxypyridin-1-ium-1-yl)butane-1-sulfonic acid (PubChem CID 140687182) has the molecular formula C10H16NO5S2+ and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-(4-methylsulfanylperoxypyridin-1-ium-1-yl)butane-1-sulfonic acid.
| Compound Name | 4-(4-methylsulfanylperoxypyridin-1-ium-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 140687182 |
| Molecular Formula | C10H16NO5S2+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-(4-methylsulfanylperoxypyridin-1-ium-1-yl)butane-1-sulfonic acid |
| SMILES | CSOOc1cc[n+](CCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H15NO5S2/c1-17-16-15-10-4-7-11(8-5-10)6-2-3-9-18(12,13)14/h4-5,7-8H,2-3,6,9H2,1H3/p+1 |
| InChIKey | AWWQMXUFDSWYEM-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|