C11H16O6S2 — CID 58914102
4-(4-methylsulfanylperoxyphenoxy)butane-1-sulfonic acid (PubChem CID 58914102) has the molecular formula C11H16O6S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-(4-methylsulfanylperoxyphenoxy)butane-1-sulfonic acid.
| Compound Name | 4-(4-methylsulfanylperoxyphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58914102 |
| Molecular Formula | C11H16O6S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-(4-methylsulfanylperoxyphenoxy)butane-1-sulfonic acid |
| SMILES | CSOOc1ccc(OCCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H16O6S2/c1-18-17-16-11-6-4-10(5-7-11)15-8-2-3-9-19(12,13)14/h4-7H,2-3,8-9H2,1H3,(H,12,13,14) |
| InChIKey | FPPYXOCFSRRGQN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|