C13H20O4S2 — CID 54405286
3-(4-butan-2-ylsulfanylphenoxy)propane-1-sulfonic acid (PubChem CID 54405286) has the molecular formula C13H20O4S2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-(4-butan-2-ylsulfanylphenoxy)propane-1-sulfonic acid.
| Compound Name | 3-(4-butan-2-ylsulfanylphenoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 54405286 |
| Molecular Formula | C13H20O4S2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-(4-butan-2-ylsulfanylphenoxy)propane-1-sulfonic acid |
| SMILES | CCC(C)Sc1ccc(OCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H20O4S2/c1-3-11(2)18-13-7-5-12(6-8-13)17-9-4-10-19(14,15)16/h5-8,11H,3-4,9-10H2,1-2H3,(H,14,15,16) |
| InChIKey | VQGMXRSQDLQMGE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|