4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride

C12H17FO4S — CID 165453434

IUPAC4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride
SMILESCCOc1ccc(OCCCCS(=O)(=O)F)cc1
InChIInChI=1S/C12H17FO4S/c1-2-16-11-5-7-12(8-6-11)17-9-3-4-10-18(13,14)15/h5-8H,2-4,9-10H2,1H3
InChIKeyJICOSDKMHSVVSJ-UHFFFAOYSA-N
MW276.33 g/mol
LogP2.54
Rot. Bonds8

About 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride

4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride (PubChem CID 165453434) has the molecular formula C12H17FO4S and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride.

Molecular Properties

Compound Name4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride
PubChem CID165453434
Molecular FormulaC12H17FO4S
Molecular Weight276.33 g/mol
Exact Mass276.08
IUPAC Name4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride
SMILESCCOc1ccc(OCCCCS(=O)(=O)F)cc1
InChIInChI=1S/C12H17FO4S/c1-2-16-11-5-7-12(8-6-11)17-9-3-4-10-18(13,14)15/h5-8H,2-4,9-10H2,1H3
InChIKeyJICOSDKMHSVVSJ-UHFFFAOYSA-N
XLogP2.54
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.33
LogP ≤ 52.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride?
The IUPAC name of 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride (CID 165453434) is 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride.
What is the SMILES notation for 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride?
The canonical SMILES for 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride is CCOc1ccc(OCCCCS(=O)(=O)F)cc1.
What is the InChIKey of 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride?
The InChIKey is JICOSDKMHSVVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FO4S/c1-2-16-11-5-7-12(8-6-11)17-9-3-4-10-18(13,14)15/h5-8H,2-4,9-10H2,1H3.
What are the key properties of 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride?
4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride has a molecular weight of 276.33 g/mol, XLogP of 2.54, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethoxyphenoxy)butane-1-sulfonyl fluoride is sourced from PubChem (CID 165453434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).