C10H14NO4S+ — CID 23568119
4-(4-formylpyridin-1-ium-1-yl)butane-1-sulfonic acid (PubChem CID 23568119) has the molecular formula C10H14NO4S+ and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(4-formylpyridin-1-ium-1-yl)butane-1-sulfonic acid.
| Compound Name | 4-(4-formylpyridin-1-ium-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 23568119 |
| Molecular Formula | C10H14NO4S+ |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-(4-formylpyridin-1-ium-1-yl)butane-1-sulfonic acid |
| SMILES | O=Cc1cc[n+](CCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO4S/c12-9-10-3-6-11(7-4-10)5-1-2-8-16(13,14)15/h3-4,6-7,9H,1-2,5,8H2/p+1 |
| InChIKey | PULRMAJJWNTTKR-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|