C14H24N2O6S+2 — CID 173099457
carboxymethyl(trimethyl)azanium;3-(3-formylpyridin-1-ium-1-yl)propane-1-sulfonic acid (PubChem CID 173099457) has the molecular formula C14H24N2O6S+2 and a molecular weight of 348.42 g/mol. Its IUPAC name is carboxymethyl(trimethyl)azanium;3-(3-formylpyridin-1-ium-1-yl)propane-1-sulfonic acid.
| Compound Name | carboxymethyl(trimethyl)azanium;3-(3-formylpyridin-1-ium-1-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173099457 |
| Molecular Formula | C14H24N2O6S+2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | carboxymethyl(trimethyl)azanium;3-(3-formylpyridin-1-ium-1-yl)propane-1-sulfonic acid |
| SMILES | C[N+](C)(C)CC(=O)O.O=Cc1ccc[n+](CCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H11NO4S.C5H11NO2/c11-8-9-3-1-4-10(7-9)5-2-6-15(12,13)14;1-6(2,3)4-5(7)8/h1,3-4,7-8H,2,5-6H2;4H2,1-3H3/p+2 |
| InChIKey | VIXCRPRHLGBEMZ-UHFFFAOYSA-P |
| XLogP | -0.16 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|