C9H13F3NO6S2+ — CID 71510468
3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid (PubChem CID 71510468) has the molecular formula C9H13F3NO6S2+ and a molecular weight of 352.33 g/mol. Its IUPAC name is 3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid.
| Compound Name | 3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 71510468 |
| Molecular Formula | C9H13F3NO6S2+ |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 3-pyridin-1-ium-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.O=S(=O)(O)CCC[n+]1ccccc1 |
| InChI | InChI=1S/C8H11NO3S.CHF3O3S/c10-13(11,12)8-4-7-9-5-2-1-3-6-9;2-1(3,4)8(5,6)7/h1-3,5-6H,4,7-8H2;(H,5,6,7)/p+1 |
| InChIKey | LLOWBQCNXDQAMW-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|