C10H13F3NO5S2+ — CID 87059951
trifluoromethylsulfonyl 4-pyridin-1-ium-1-ylbutane-1-sulfonate (PubChem CID 87059951) has the molecular formula C10H13F3NO5S2+ and a molecular weight of 348.34 g/mol. Its IUPAC name is trifluoromethylsulfonyl 4-pyridin-1-ium-1-ylbutane-1-sulfonate.
| Compound Name | trifluoromethylsulfonyl 4-pyridin-1-ium-1-ylbutane-1-sulfonate |
|---|---|
| PubChem CID | 87059951 |
| Molecular Formula | C10H13F3NO5S2+ |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | trifluoromethylsulfonyl 4-pyridin-1-ium-1-ylbutane-1-sulfonate |
| SMILES | O=S(=O)(CCCC[n+]1ccccc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3NO5S2/c11-10(12,13)21(17,18)19-20(15,16)9-5-4-8-14-6-2-1-3-7-14/h1-3,6-7H,4-5,8-9H2/q+1 |
| InChIKey | UPVQEGSQXCPNIT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|