About trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate
trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate (PubChem CID 87060004) has the molecular formula C9H15F3N2O5S2
and a molecular weight of 352.36 g/mol. Its IUPAC name is trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate.
Molecular Properties
| Compound Name | trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate |
| PubChem CID | 87060004 |
| Molecular Formula | C9H15F3N2O5S2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate |
| SMILES | CCN1C=CN(CCCS(=O)(=O)OS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O5S2/c1-2-13-5-6-14(8-13)4-3-7-20(15,16)19-21(17,18)9(10,11)12/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | BNHCJCXMCVDYHC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate?
The IUPAC name of trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate (CID 87060004) is trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate.
What is the SMILES notation for trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate?
The canonical SMILES for trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate is CCN1C=CN(CCCS(=O)(=O)OS(=O)(=O)C(F)(F)F)C1.
What is the InChIKey of trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate?
The InChIKey is BNHCJCXMCVDYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O5S2/c1-2-13-5-6-14(8-13)4-3-7-20(15,16)19-21(17,18)9(10,11)12/h5-6H,2-4,7-8H2,1H3.
What are the key properties of trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate?
trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate has a molecular weight of 352.36 g/mol, XLogP of 0.64, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate is sourced from PubChem (CID 87060004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).