C9H15F3N2O5S2 — CID 87060004
trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate (PubChem CID 87060004) has the molecular formula C9H15F3N2O5S2 and a molecular weight of 352.36 g/mol. Its IUPAC name is trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate.
| Compound Name | trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 87060004 |
| Molecular Formula | C9H15F3N2O5S2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | trifluoromethylsulfonyl 3-(3-ethyl-2H-imidazol-1-yl)propane-1-sulfonate |
| SMILES | CCN1C=CN(CCCS(=O)(=O)OS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O5S2/c1-2-13-5-6-14(8-13)4-3-7-20(15,16)19-21(17,18)9(10,11)12/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | BNHCJCXMCVDYHC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|