About disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate
disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate (PubChem CID 174786475) has the molecular formula C13H26N2O3S3
and a molecular weight of 354.56 g/mol. Its IUPAC name is disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate.
Molecular Properties
| Compound Name | disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate |
| PubChem CID | 174786475 |
| Molecular Formula | C13H26N2O3S3 |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate |
| SMILES | CCCCCCN1C=CN(CCCCS(=O)(=O)OSS)C1 |
| InChI | InChI=1S/C13H26N2O3S3/c1-2-3-4-5-8-14-10-11-15(13-14)9-6-7-12-21(16,17)18-20-19/h10-11,19H,2-9,12-13H2,1H3 |
| InChIKey | MGMLFXDIPZKWTJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate?
The IUPAC name of disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate (CID 174786475) is disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate.
What is the SMILES notation for disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate?
The canonical SMILES for disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate is CCCCCCN1C=CN(CCCCS(=O)(=O)OSS)C1.
What is the InChIKey of disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate?
The InChIKey is MGMLFXDIPZKWTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3S3/c1-2-3-4-5-8-14-10-11-15(13-14)9-6-7-12-21(16,17)18-20-19/h10-11,19H,2-9,12-13H2,1H3.
What are the key properties of disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate?
disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate has a molecular weight of 354.56 g/mol, XLogP of 3.23, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disulfanyl 4-(3-hexyl-2H-imidazol-1-yl)butane-1-sulfonate is sourced from PubChem (CID 174786475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).