C15H26NO8S2-3 — CID 21146196
10-pyridin-1-ium-1-yldecan-1-ol;sulfate;sulfite (PubChem CID 21146196) has the molecular formula C15H26NO8S2-3 and a molecular weight of 412.51 g/mol. Its IUPAC name is 10-pyridin-1-ium-1-yldecan-1-ol;sulfate;sulfite.
| Compound Name | 10-pyridin-1-ium-1-yldecan-1-ol;sulfate;sulfite |
|---|---|
| PubChem CID | 21146196 |
| Molecular Formula | C15H26NO8S2-3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 10-pyridin-1-ium-1-yldecan-1-ol;sulfate;sulfite |
| SMILES | O=S(=O)([O-])[O-].O=S([O-])[O-].OCCCCCCCCCC[n+]1ccccc1 |
| InChI | InChI=1S/C15H26NO.H2O4S.H2O3S/c17-15-11-6-4-2-1-3-5-8-12-16-13-9-7-10-14-16;1-5(2,3)4;1-4(2)3/h7,9-10,13-14,17H,1-6,8,11-12,15H2;(H2,1,2,3,4);(H2,1,2,3)/q+1;;/p-4 |
| InChIKey | AWXRPZBIBCIVHN-UHFFFAOYSA-J |
| XLogP | 0.75 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|