About 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate
1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate (PubChem CID 139061762) has the molecular formula C12H14N2O8S2
and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate.
Molecular Properties
| Compound Name | 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate |
| PubChem CID | 139061762 |
| Molecular Formula | C12H14N2O8S2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate |
| SMILES | O=S(=O)([O-])OOS(=O)(=O)[O-].c1cc[n+](CC[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C12H14N2.H2O8S2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-9(2,3)7-8-10(4,5)6/h1-10H,11-12H2;(H,1,2,3)(H,4,5,6)/q+2;/p-2 |
| InChIKey | SNJVBWTXWDAUHT-UHFFFAOYSA-L |
| XLogP | -1.18 |
| TPSA | 140.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate?
The IUPAC name of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate (CID 139061762) is 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate.
What is the SMILES notation for 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate?
The canonical SMILES for 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate is O=S(=O)([O-])OOS(=O)(=O)[O-].c1cc[n+](CC[n+]2ccccc2)cc1.
What is the InChIKey of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate?
The InChIKey is SNJVBWTXWDAUHT-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H14N2.H2O8S2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-9(2,3)7-8-10(4,5)6/h1-10H,11-12H2;(H,1,2,3)(H,4,5,6)/q+2;/p-2.
What are the key properties of 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate?
1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate has a molecular weight of 378.38 g/mol, XLogP of -1.18, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-pyridin-1-ium-1-ylethyl)pyridin-1-ium;sulfonatooxy sulfate is sourced from PubChem (CID 139061762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).