About dipotassium;sulfonatooxy sulfate
dipotassium;sulfonatooxy sulfate (PubChem CID 516926) has the molecular formula K2O8S2
and a molecular weight of 270.32 g/mol. Its IUPAC name is dipotassium;sulfonatooxy sulfate.
Molecular Properties
| Compound Name | dipotassium;sulfonatooxy sulfate |
| PubChem CID | 516926 |
| Molecular Formula | K2O8S2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 269.83 |
| IUPAC Name | dipotassium;sulfonatooxy sulfate |
| SMILES | O=S(=O)([O-])OOS(=O)(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/2K.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
| InChIKey | USHAGKDGDHPEEY-UHFFFAOYSA-L |
| XLogP | -8.14 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;sulfonatooxy sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;sulfonatooxy sulfate?
The IUPAC name of dipotassium;sulfonatooxy sulfate (CID 516926) is dipotassium;sulfonatooxy sulfate.
What is the SMILES notation for dipotassium;sulfonatooxy sulfate?
The canonical SMILES for dipotassium;sulfonatooxy sulfate is O=S(=O)([O-])OOS(=O)(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;sulfonatooxy sulfate?
The InChIKey is USHAGKDGDHPEEY-UHFFFAOYSA-L. The full InChI is InChI=1S/2K.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2.
What are the key properties of dipotassium;sulfonatooxy sulfate?
dipotassium;sulfonatooxy sulfate has a molecular weight of 270.32 g/mol, XLogP of -8.14, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;sulfonatooxy sulfate is sourced from PubChem (CID 516926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).