About bis(rubidium(1+));sulfonatooxy sulfate
bis(rubidium(1+));sulfonatooxy sulfate (PubChem CID 18406061) has the molecular formula O8Rb2S2
and a molecular weight of 363.06 g/mol. Its IUPAC name is bis(rubidium(1+));sulfonatooxy sulfate.
Molecular Properties
| Compound Name | bis(rubidium(1+));sulfonatooxy sulfate |
| PubChem CID | 18406061 |
| Molecular Formula | O8Rb2S2 |
| Molecular Weight | 363.06 g/mol |
| Exact Mass | 361.73 |
| IUPAC Name | bis(rubidium(1+));sulfonatooxy sulfate |
| SMILES | O=S(=O)([O-])OOS(=O)(=O)[O-].[Rb+].[Rb+] |
| InChI | InChI=1S/H2O8S2.2Rb/c1-9(2,3)7-8-10(4,5)6;;/h(H,1,2,3)(H,4,5,6);;/q;2*+1/p-2 |
| InChIKey | MDARCKRSNKXOPH-UHFFFAOYSA-L |
| XLogP | -8.14 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.06 |
| LogP ≤ 5 | -8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(rubidium(1+));sulfonatooxy sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(rubidium(1+));sulfonatooxy sulfate?
The IUPAC name of bis(rubidium(1+));sulfonatooxy sulfate (CID 18406061) is bis(rubidium(1+));sulfonatooxy sulfate.
What is the SMILES notation for bis(rubidium(1+));sulfonatooxy sulfate?
The canonical SMILES for bis(rubidium(1+));sulfonatooxy sulfate is O=S(=O)([O-])OOS(=O)(=O)[O-].[Rb+].[Rb+].
What is the InChIKey of bis(rubidium(1+));sulfonatooxy sulfate?
The InChIKey is MDARCKRSNKXOPH-UHFFFAOYSA-L. The full InChI is InChI=1S/H2O8S2.2Rb/c1-9(2,3)7-8-10(4,5)6;;/h(H,1,2,3)(H,4,5,6);;/q;2*+1/p-2.
What are the key properties of bis(rubidium(1+));sulfonatooxy sulfate?
bis(rubidium(1+));sulfonatooxy sulfate has a molecular weight of 363.06 g/mol, XLogP of -8.14, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(rubidium(1+));sulfonatooxy sulfate is sourced from PubChem (CID 18406061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).