C12H19NO5S — CID 11818577
propan-2-yl sulfate;4-pyridin-1-ium-1-ylbutan-2-one (PubChem CID 11818577) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is propan-2-yl sulfate;4-pyridin-1-ium-1-ylbutan-2-one.
| Compound Name | propan-2-yl sulfate;4-pyridin-1-ium-1-ylbutan-2-one |
|---|---|
| PubChem CID | 11818577 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | propan-2-yl sulfate;4-pyridin-1-ium-1-ylbutan-2-one |
| SMILES | CC(=O)CC[n+]1ccccc1.CC(C)OS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H12NO.C3H8O4S/c1-9(11)5-8-10-6-3-2-4-7-10;1-3(2)7-8(4,5)6/h2-4,6-7H,5,8H2,1H3;3H,1-2H3,(H,4,5,6)/q+1;/p-1 |
| InChIKey | UKULBKPTPBOSKC-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|