C13H19BrN2O3 — CID 82033893
3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)butanoic acid bromide (PubChem CID 82033893) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is 3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)butanoic acid bromide.
| Compound Name | 3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)butanoic acid bromide |
|---|---|
| PubChem CID | 82033893 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-methyl-2-(3-pyridin-1-ium-1-ylpropanoylamino)butanoic acid bromide |
| SMILES | CC(C)C(NC(=O)CC[n+]1ccccc1)C(=O)O.[Br-] |
| InChI | InChI=1S/C13H18N2O3.BrH/c1-10(2)12(13(17)18)14-11(16)6-9-15-7-4-3-5-8-15;/h3-5,7-8,10,12H,6,9H2,1-2H3,(H-,14,16,17,18);1H |
| InChIKey | YGLSRSMENGZUPI-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|